C13H21F3O2 — CID 139332528
4,4,4-trifluorobutyl 4-ethylhept-6-enoate (PubChem CID 139332528) has the molecular formula C13H21F3O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 4,4,4-trifluorobutyl 4-ethylhept-6-enoate.
| Compound Name | 4,4,4-trifluorobutyl 4-ethylhept-6-enoate |
|---|---|
| PubChem CID | 139332528 |
| Molecular Formula | C13H21F3O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 4,4,4-trifluorobutyl 4-ethylhept-6-enoate |
| SMILES | C=CCC(CC)CCC(=O)OCCCC(F)(F)F |
| InChI | InChI=1S/C13H21F3O2/c1-3-6-11(4-2)7-8-12(17)18-10-5-9-13(14,15)16/h3,11H,1,4-10H2,2H3 |
| InChIKey | QNFLQVPMSWUDFO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|