C16H26F2N2 — CID 139332605
1-[1-[(4E)-8,8-difluoronona-4,6-dien-4-yl]pyrrolidin-3-yl]-N-methylethenamine (PubChem CID 139332605) has the molecular formula C16H26F2N2 and a molecular weight of 284.39 g/mol. Its IUPAC name is 1-[1-[(4E)-8,8-difluoronona-4,6-dien-4-yl]pyrrolidin-3-yl]-N-methylethenamine.
| Compound Name | 1-[1-[(4E)-8,8-difluoronona-4,6-dien-4-yl]pyrrolidin-3-yl]-N-methylethenamine |
|---|---|
| PubChem CID | 139332605 |
| Molecular Formula | C16H26F2N2 |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 1-[1-[(4E)-8,8-difluoronona-4,6-dien-4-yl]pyrrolidin-3-yl]-N-methylethenamine |
| SMILES | C=C(NC)C1CCN(/C(=C/C=CC(C)(F)F)CCC)C1 |
| InChI | InChI=1S/C16H26F2N2/c1-5-7-15(8-6-10-16(3,17)18)20-11-9-14(12-20)13(2)19-4/h6,8,10,14,19H,2,5,7,9,11-12H2,1,3-4H3/b10-6?,15-8+ |
| InChIKey | SNSJMLOETHQTFQ-KMTXYMTOSA-N |
| XLogP | 3.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|