C10H11F3N6 — CID 139332636
2-[3,5-bis(cyanomethyl)-4-(trifluoromethyl)-1,3,5-triazinan-1-yl]acetonitrile (PubChem CID 139332636) has the molecular formula C10H11F3N6 and a molecular weight of 272.23 g/mol. Its IUPAC name is 2-[3,5-bis(cyanomethyl)-4-(trifluoromethyl)-1,3,5-triazinan-1-yl]acetonitrile.
| Compound Name | 2-[3,5-bis(cyanomethyl)-4-(trifluoromethyl)-1,3,5-triazinan-1-yl]acetonitrile |
|---|---|
| PubChem CID | 139332636 |
| Molecular Formula | C10H11F3N6 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-[3,5-bis(cyanomethyl)-4-(trifluoromethyl)-1,3,5-triazinan-1-yl]acetonitrile |
| SMILES | N#CCN1CN(CC#N)C(C(F)(F)F)N(CC#N)C1 |
| InChI | InChI=1S/C10H11F3N6/c11-10(12,13)9-18(5-2-15)7-17(4-1-14)8-19(9)6-3-16/h9H,4-8H2 |
| InChIKey | HJNUVDDTRWMFJD-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 81.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|