About 1-[methoxy-[4-(3,4,5-trifluorophenyl)cyclohexyl]methoxy]propane-2-thiol
1-[methoxy-[4-(3,4,5-trifluorophenyl)cyclohexyl]methoxy]propane-2-thiol (PubChem CID 139333211) has the molecular formula C17H23F3O2S
and a molecular weight of 348.43 g/mol. Its IUPAC name is 1-[methoxy-[4-(3,4,5-trifluorophenyl)cyclohexyl]methoxy]propane-2-thiol.
Molecular Properties
| Compound Name | 1-[methoxy-[4-(3,4,5-trifluorophenyl)cyclohexyl]methoxy]propane-2-thiol |
| PubChem CID | 139333211 |
| Molecular Formula | C17H23F3O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-[methoxy-[4-(3,4,5-trifluorophenyl)cyclohexyl]methoxy]propane-2-thiol |
| SMILES | COC(OCC(C)S)C1CCC(c2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C17H23F3O2S/c1-10(23)9-22-17(21-2)12-5-3-11(4-6-12)13-7-14(18)16(20)15(19)8-13/h7-8,10-12,17,23H,3-6,9H2,1-2H3 |
| InChIKey | LSEKHXMKVPIRDW-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[methoxy-[4-(3,4,5-trifluorophenyl)cyclohexyl]methoxy]propane-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[methoxy-[4-(3,4,5-trifluorophenyl)cyclohexyl]methoxy]propane-2-thiol?
The IUPAC name of 1-[methoxy-[4-(3,4,5-trifluorophenyl)cyclohexyl]methoxy]propane-2-thiol (CID 139333211) is 1-[methoxy-[4-(3,4,5-trifluorophenyl)cyclohexyl]methoxy]propane-2-thiol.
What is the SMILES notation for 1-[methoxy-[4-(3,4,5-trifluorophenyl)cyclohexyl]methoxy]propane-2-thiol?
The canonical SMILES for 1-[methoxy-[4-(3,4,5-trifluorophenyl)cyclohexyl]methoxy]propane-2-thiol is COC(OCC(C)S)C1CCC(c2cc(F)c(F)c(F)c2)CC1.
What is the InChIKey of 1-[methoxy-[4-(3,4,5-trifluorophenyl)cyclohexyl]methoxy]propane-2-thiol?
The InChIKey is LSEKHXMKVPIRDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23F3O2S/c1-10(23)9-22-17(21-2)12-5-3-11(4-6-12)13-7-14(18)16(20)15(19)8-13/h7-8,10-12,17,23H,3-6,9H2,1-2H3.
What are the key properties of 1-[methoxy-[4-(3,4,5-trifluorophenyl)cyclohexyl]methoxy]propane-2-thiol?
1-[methoxy-[4-(3,4,5-trifluorophenyl)cyclohexyl]methoxy]propane-2-thiol has a molecular weight of 348.43 g/mol, XLogP of 4.69, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[methoxy-[4-(3,4,5-trifluorophenyl)cyclohexyl]methoxy]propane-2-thiol is sourced from PubChem (CID 139333211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).