C22H25N7 — CID 139333387
3-[1-[[4-(4-aminopiperidin-1-yl)-3-pyridinyl]amino]ethenyl]-5-phenylpyrazin-2-amine (PubChem CID 139333387) has the molecular formula C22H25N7 and a molecular weight of 387.49 g/mol. Its IUPAC name is 3-[1-[[4-(4-aminopiperidin-1-yl)-3-pyridinyl]amino]ethenyl]-5-phenylpyrazin-2-amine.
| Compound Name | 3-[1-[[4-(4-aminopiperidin-1-yl)-3-pyridinyl]amino]ethenyl]-5-phenylpyrazin-2-amine |
|---|---|
| PubChem CID | 139333387 |
| Molecular Formula | C22H25N7 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 3-[1-[[4-(4-aminopiperidin-1-yl)-3-pyridinyl]amino]ethenyl]-5-phenylpyrazin-2-amine |
| SMILES | C=C(Nc1cnccc1N1CCC(N)CC1)c1nc(-c2ccccc2)cnc1N |
| InChI | InChI=1S/C22H25N7/c1-15(21-22(24)26-14-18(28-21)16-5-3-2-4-6-16)27-19-13-25-10-7-20(19)29-11-8-17(23)9-12-29/h2-7,10,13-14,17,27H,1,8-9,11-12,23H2,(H2,24,26) |
| InChIKey | ITWLSEDDUFDBAC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |