C18H20F2N6O4 — CID 139333556
3,3-difluoro-N-[(E)-C-[7-(1-formylpiperidin-4-yl)-5-oxo-4H-pyrazolo[1,5-a]pyrimidin-3-yl]-N-hydroxycarbonimidoyl]cyclobutane-1-carboxamide (PubChem CID 139333556) has the molecular formula C18H20F2N6O4 and a molecular weight of 422.39 g/mol. Its IUPAC name is 3,3-difluoro-N-[(E)-C-[7-(1-formylpiperidin-4-yl)-5-oxo-4H-pyrazolo[1,5-a]pyrimidin-3-yl]-N-hydroxycarbonimidoyl]cyclobutane-1-carboxamide.
| Compound Name | 3,3-difluoro-N-[(E)-C-[7-(1-formylpiperidin-4-yl)-5-oxo-4H-pyrazolo[1,5-a]pyrimidin-3-yl]-N-hydroxycarbonimidoyl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 139333556 |
| Molecular Formula | C18H20F2N6O4 |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 3,3-difluoro-N-[(E)-C-[7-(1-formylpiperidin-4-yl)-5-oxo-4H-pyrazolo[1,5-a]pyrimidin-3-yl]-N-hydroxycarbonimidoyl]cyclobutane-1-carboxamide |
| SMILES | O=CN1CCC(c2cc(=O)[nH]c3c(/C(=N\O)NC(=O)C4CC(F)(F)C4)cnn23)CC1 |
| InChI | InChI=1S/C18H20F2N6O4/c19-18(20)6-11(7-18)17(29)23-15(24-30)12-8-21-26-13(5-14(28)22-16(12)26)10-1-3-25(9-27)4-2-10/h5,8-11,30H,1-4,6-7H2,(H,22,28)(H,23,24,29) |
| InChIKey | YBEAWNKALWCLFW-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|