C15H15N3S — CID 139333741
4-(4-cyclopropyl-1,2-dihydronaphthalen-1-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 139333741) has the molecular formula C15H15N3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 4-(4-cyclopropyl-1,2-dihydronaphthalen-1-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(4-cyclopropyl-1,2-dihydronaphthalen-1-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 139333741 |
| Molecular Formula | C15H15N3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 4-(4-cyclopropyl-1,2-dihydronaphthalen-1-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]ncn1C1CC=C(C2CC2)c2ccccc21 |
| InChI | InChI=1S/C15H15N3S/c19-15-17-16-9-18(15)14-8-7-11(10-5-6-10)12-3-1-2-4-13(12)14/h1-4,7,9-10,14H,5-6,8H2,(H,17,19) |
| InChIKey | ASJWSWWNZUDRRK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|