C10H21N — CID 139333872
3,3,5,5-tetramethylhexan-2-imine (PubChem CID 139333872) has the molecular formula C10H21N and a molecular weight of 155.28 g/mol. Its IUPAC name is 3,3,5,5-tetramethylhexan-2-imine.
| Compound Name | 3,3,5,5-tetramethylhexan-2-imine |
|---|---|
| PubChem CID | 139333872 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | 3,3,5,5-tetramethylhexan-2-imine |
| SMILES | [H]/N=C(\C)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C10H21N/c1-8(11)10(5,6)7-9(2,3)4/h11H,7H2,1-6H3/b11-8+ |
| InChIKey | LWODQJMNTRBMAM-DHZHZOJOSA-N |
| XLogP | 3.49 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|