About 1-(6-methoxy-3-pyridinyl)-5,6-dimethylindazole
1-(6-methoxy-3-pyridinyl)-5,6-dimethylindazole (PubChem CID 139333949) has the molecular formula C15H15N3O
and a molecular weight of 253.30 g/mol. Its IUPAC name is 1-(6-methoxy-3-pyridinyl)-5,6-dimethylindazole.
Molecular Properties
| Compound Name | 1-(6-methoxy-3-pyridinyl)-5,6-dimethylindazole |
| PubChem CID | 139333949 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 1-(6-methoxy-3-pyridinyl)-5,6-dimethylindazole |
| SMILES | COc1ccc(-n2ncc3cc(C)c(C)cc32)cn1 |
| InChI | InChI=1S/C15H15N3O/c1-10-6-12-8-17-18(14(12)7-11(10)2)13-4-5-15(19-3)16-9-13/h4-9H,1-3H3 |
| InChIKey | BRIULLUPJDZGNT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(6-methoxy-3-pyridinyl)-5,6-dimethylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-methoxy-3-pyridinyl)-5,6-dimethylindazole?
The IUPAC name of 1-(6-methoxy-3-pyridinyl)-5,6-dimethylindazole (CID 139333949) is 1-(6-methoxy-3-pyridinyl)-5,6-dimethylindazole.
What is the SMILES notation for 1-(6-methoxy-3-pyridinyl)-5,6-dimethylindazole?
The canonical SMILES for 1-(6-methoxy-3-pyridinyl)-5,6-dimethylindazole is COc1ccc(-n2ncc3cc(C)c(C)cc32)cn1.
What is the InChIKey of 1-(6-methoxy-3-pyridinyl)-5,6-dimethylindazole?
The InChIKey is BRIULLUPJDZGNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O/c1-10-6-12-8-17-18(14(12)7-11(10)2)13-4-5-15(19-3)16-9-13/h4-9H,1-3H3.
What are the key properties of 1-(6-methoxy-3-pyridinyl)-5,6-dimethylindazole?
1-(6-methoxy-3-pyridinyl)-5,6-dimethylindazole has a molecular weight of 253.30 g/mol, XLogP of 3.05, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-methoxy-3-pyridinyl)-5,6-dimethylindazole is sourced from PubChem (CID 139333949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).