C22H22N4O4 — CID 139334576
8-(formamidomethyl)-5-(3-methoxyphenyl)-N-(1,2-oxazol-3-yl)-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 139334576) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is 8-(formamidomethyl)-5-(3-methoxyphenyl)-N-(1,2-oxazol-3-yl)-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | 8-(formamidomethyl)-5-(3-methoxyphenyl)-N-(1,2-oxazol-3-yl)-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 139334576 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 8-(formamidomethyl)-5-(3-methoxyphenyl)-N-(1,2-oxazol-3-yl)-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | COc1cccc(-c2ccc(CNC=O)c3c2CCN(C(=O)Nc2ccon2)C3)c1 |
| InChI | InChI=1S/C22H22N4O4/c1-29-17-4-2-3-15(11-17)18-6-5-16(12-23-14-27)20-13-26(9-7-19(18)20)22(28)24-21-8-10-30-25-21/h2-6,8,10-11,14H,7,9,12-13H2,1H3,(H,23,27)(H,24,25,28) |
| InChIKey | UQOGNXZTQSDABL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|