C13H21NO — CID 139334640
4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]oxypiperidine (PubChem CID 139334640) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]oxypiperidine.
| Compound Name | 4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]oxypiperidine |
|---|---|
| PubChem CID | 139334640 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]oxypiperidine |
| SMILES | C/C=C\C=C(/C=C\C)OC1CCNCC1 |
| InChI | InChI=1S/C13H21NO/c1-3-5-7-12(6-4-2)15-13-8-10-14-11-9-13/h3-7,13-14H,8-11H2,1-2H3/b5-3-,6-4-,12-7+ |
| InChIKey | KJCHBZXATBRRSH-WFYFVCBASA-N |
| XLogP | 2.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|