About (2-ethyl-2,3-dihydropyridin-5-yl)methanamine
(2-ethyl-2,3-dihydropyridin-5-yl)methanamine (PubChem CID 139334912) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is (2-ethyl-2,3-dihydropyridin-5-yl)methanamine.
Molecular Properties
| Compound Name | (2-ethyl-2,3-dihydropyridin-5-yl)methanamine |
| PubChem CID | 139334912 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (2-ethyl-2,3-dihydropyridin-5-yl)methanamine |
| SMILES | CCC1CC=C(CN)C=N1 |
| InChI | InChI=1S/C8H14N2/c1-2-8-4-3-7(5-9)6-10-8/h3,6,8H,2,4-5,9H2,1H3 |
| InChIKey | LJUHTPWBIXAPOA-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-ethyl-2,3-dihydropyridin-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-2,3-dihydropyridin-5-yl)methanamine?
The IUPAC name of (2-ethyl-2,3-dihydropyridin-5-yl)methanamine (CID 139334912) is (2-ethyl-2,3-dihydropyridin-5-yl)methanamine.
What is the SMILES notation for (2-ethyl-2,3-dihydropyridin-5-yl)methanamine?
The canonical SMILES for (2-ethyl-2,3-dihydropyridin-5-yl)methanamine is CCC1CC=C(CN)C=N1.
What is the InChIKey of (2-ethyl-2,3-dihydropyridin-5-yl)methanamine?
The InChIKey is LJUHTPWBIXAPOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2/c1-2-8-4-3-7(5-9)6-10-8/h3,6,8H,2,4-5,9H2,1H3.
What are the key properties of (2-ethyl-2,3-dihydropyridin-5-yl)methanamine?
(2-ethyl-2,3-dihydropyridin-5-yl)methanamine has a molecular weight of 138.21 g/mol, XLogP of 1.12, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-2,3-dihydropyridin-5-yl)methanamine is sourced from PubChem (CID 139334912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).