About 3-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1,2-dihydropyrrol-5-one
3-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1,2-dihydropyrrol-5-one (PubChem CID 139335071) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1,2-dihydropyrrol-5-one |
| PubChem CID | 139335071 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1,2-dihydropyrrol-5-one |
| SMILES | C=C/C=C\C1=C(C=C)C(=O)NC1 |
| InChI | InChI=1S/C10H11NO/c1-3-5-6-8-7-11-10(12)9(8)4-2/h3-6H,1-2,7H2,(H,11,12)/b6-5- |
| InChIKey | SQGJEGHUASLIKX-WAYWQWQTSA-N |
| XLogP | 1.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1,2-dihydropyrrol-5-one?
The IUPAC name of 3-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1,2-dihydropyrrol-5-one (CID 139335071) is 3-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1,2-dihydropyrrol-5-one.
What is the SMILES notation for 3-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1,2-dihydropyrrol-5-one?
The canonical SMILES for 3-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1,2-dihydropyrrol-5-one is C=C/C=C\C1=C(C=C)C(=O)NC1.
What is the InChIKey of 3-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1,2-dihydropyrrol-5-one?
The InChIKey is SQGJEGHUASLIKX-WAYWQWQTSA-N. The full InChI is InChI=1S/C10H11NO/c1-3-5-6-8-7-11-10(12)9(8)4-2/h3-6H,1-2,7H2,(H,11,12)/b6-5-.
What are the key properties of 3-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1,2-dihydropyrrol-5-one?
3-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1,2-dihydropyrrol-5-one has a molecular weight of 161.20 g/mol, XLogP of 1.34, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 139335071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).