C19H21Cl2N3O3S — CID 139335460
N-[4-(3,4-dichlorophenyl)but-3-yn-2-yl]-5-(ethenylsulfonylamino)-2-azabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 139335460) has the molecular formula C19H21Cl2N3O3S and a molecular weight of 442.37 g/mol. Its IUPAC name is N-[4-(3,4-dichlorophenyl)but-3-yn-2-yl]-5-(ethenylsulfonylamino)-2-azabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | N-[4-(3,4-dichlorophenyl)but-3-yn-2-yl]-5-(ethenylsulfonylamino)-2-azabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 139335460 |
| Molecular Formula | C19H21Cl2N3O3S |
| Molecular Weight | 442.37 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | N-[4-(3,4-dichlorophenyl)but-3-yn-2-yl]-5-(ethenylsulfonylamino)-2-azabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | C=CS(=O)(=O)NC1CC2CC1CN2C(=O)NC(C)C#Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H21Cl2N3O3S/c1-3-28(26,27)23-18-10-15-9-14(18)11-24(15)19(25)22-12(2)4-5-13-6-7-16(20)17(21)8-13/h3,6-8,12,14-15,18,23H,1,9-11H2,2H3,(H,22,25) |
| InChIKey | PCSORDMKYVZNNN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|