C20H24FN — CID 139335626
(3E,5Z,9Z,11Z)-3-fluoro-7,10-dimethyl-2,8,13-trimethylidene-9-[(Z)-prop-1-enyl]-1-azacyclotrideca-3,5,9,11-tetraene (PubChem CID 139335626) has the molecular formula C20H24FN and a molecular weight of 297.42 g/mol. Its IUPAC name is (3E,5Z,9Z,11Z)-3-fluoro-7,10-dimethyl-2,8,13-trimethylidene-9-[(Z)-prop-1-enyl]-1-azacyclotrideca-3,5,9,11-tetraene.
| Compound Name | (3E,5Z,9Z,11Z)-3-fluoro-7,10-dimethyl-2,8,13-trimethylidene-9-[(Z)-prop-1-enyl]-1-azacyclotrideca-3,5,9,11-tetraene |
|---|---|
| PubChem CID | 139335626 |
| Molecular Formula | C20H24FN |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | (3E,5Z,9Z,11Z)-3-fluoro-7,10-dimethyl-2,8,13-trimethylidene-9-[(Z)-prop-1-enyl]-1-azacyclotrideca-3,5,9,11-tetraene |
| SMILES | C=C1/C=C\C(C)=C(\C=C/C)C(=C)C(C)/C=C\C=C(\F)C(=C)N1 |
| InChI | InChI=1S/C20H24FN/c1-7-9-19-15(3)12-13-16(4)22-18(6)20(21)11-8-10-14(2)17(19)5/h7-14,22H,4-6H2,1-3H3/b9-7-,10-8-,13-12-,19-15-,20-11+ |
| InChIKey | YKBQOHVFSWBYNB-XWGPBFAUSA-N |
| XLogP | 5.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |