About N,N-dimethyl-N'-(methylideneamino)-N'-[(Z)-7-methyloct-2-en-3-yl]propane-1,3-diamine
N,N-dimethyl-N'-(methylideneamino)-N'-[(Z)-7-methyloct-2-en-3-yl]propane-1,3-diamine (PubChem CID 139335643) has the molecular formula C15H31N3
and a molecular weight of 253.43 g/mol. Its IUPAC name is N,N-dimethyl-N'-(methylideneamino)-N'-[(Z)-7-methyloct-2-en-3-yl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N,N-dimethyl-N'-(methylideneamino)-N'-[(Z)-7-methyloct-2-en-3-yl]propane-1,3-diamine |
| PubChem CID | 139335643 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | N,N-dimethyl-N'-(methylideneamino)-N'-[(Z)-7-methyloct-2-en-3-yl]propane-1,3-diamine |
| SMILES | C=NN(CCCN(C)C)/C(=C\C)CCCC(C)C |
| InChI | InChI=1S/C15H31N3/c1-7-15(11-8-10-14(2)3)18(16-4)13-9-12-17(5)6/h7,14H,4,8-13H2,1-3,5-6H3/b15-7- |
| InChIKey | ISDCKQBTDCICRN-CHHVJCJISA-N |
| XLogP | 3.59 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-N'-(methylideneamino)-N'-[(Z)-7-methyloct-2-en-3-yl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-N'-(methylideneamino)-N'-[(Z)-7-methyloct-2-en-3-yl]propane-1,3-diamine?
The IUPAC name of N,N-dimethyl-N'-(methylideneamino)-N'-[(Z)-7-methyloct-2-en-3-yl]propane-1,3-diamine (CID 139335643) is N,N-dimethyl-N'-(methylideneamino)-N'-[(Z)-7-methyloct-2-en-3-yl]propane-1,3-diamine.
What is the SMILES notation for N,N-dimethyl-N'-(methylideneamino)-N'-[(Z)-7-methyloct-2-en-3-yl]propane-1,3-diamine?
The canonical SMILES for N,N-dimethyl-N'-(methylideneamino)-N'-[(Z)-7-methyloct-2-en-3-yl]propane-1,3-diamine is C=NN(CCCN(C)C)/C(=C\C)CCCC(C)C.
What is the InChIKey of N,N-dimethyl-N'-(methylideneamino)-N'-[(Z)-7-methyloct-2-en-3-yl]propane-1,3-diamine?
The InChIKey is ISDCKQBTDCICRN-CHHVJCJISA-N. The full InChI is InChI=1S/C15H31N3/c1-7-15(11-8-10-14(2)3)18(16-4)13-9-12-17(5)6/h7,14H,4,8-13H2,1-3,5-6H3/b15-7-.
What are the key properties of N,N-dimethyl-N'-(methylideneamino)-N'-[(Z)-7-methyloct-2-en-3-yl]propane-1,3-diamine?
N,N-dimethyl-N'-(methylideneamino)-N'-[(Z)-7-methyloct-2-en-3-yl]propane-1,3-diamine has a molecular weight of 253.43 g/mol, XLogP of 3.59, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-N'-(methylideneamino)-N'-[(Z)-7-methyloct-2-en-3-yl]propane-1,3-diamine is sourced from PubChem (CID 139335643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).