C25H27F3N8O2S — CID 139335762
tert-butyl N-[(1S,2S)-2-[[4-[6-(3-methyl-1,2,4-thiadiazol-5-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]cyclopentyl]carbamate (PubChem CID 139335762) has the molecular formula C25H27F3N8O2S and a molecular weight of 560.61 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S)-2-[[4-[6-(3-methyl-1,2,4-thiadiazol-5-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2S)-2-[[4-[6-(3-methyl-1,2,4-thiadiazol-5-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 139335762 |
| Molecular Formula | C25H27F3N8O2S |
| Molecular Weight | 560.61 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | tert-butyl N-[(1S,2S)-2-[[4-[6-(3-methyl-1,2,4-thiadiazol-5-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]cyclopentyl]carbamate |
| SMILES | Cc1nsc(-c2ccc3c(-c4nc(N[C@H]5CCC[C@@H]5NC(=O)OC(C)(C)C)ncc4C(F)(F)F)c[nH]c3n2)n1 |
| InChI | InChI=1S/C25H27F3N8O2S/c1-12-31-21(39-36-12)18-9-8-13-14(10-29-20(13)32-18)19-15(25(26,27)28)11-30-22(35-19)33-16-6-5-7-17(16)34-23(37)38-24(2,3)4/h8-11,16-17H,5-7H2,1-4H3,(H,29,32)(H,34,37)(H,30,33,35)/t16-,17-/m0/s1 |
| InChIKey | ADYVCMJYAGNBQW-IRXDYDNUSA-N |
| XLogP | 5.72 |
| TPSA | 130.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.61 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |