C26H27NO6S — CID 139336204
(6R)-9-(3-methoxypropoxy)-3,3-dimethyl-15-oxo-10-thiophen-3-yl-4-oxa-1-azatetracyclo[11.4.0.02,6.07,12]heptadeca-7(12),8,10,13,16-pentaene-16-carboxylic acid (PubChem CID 139336204) has the molecular formula C26H27NO6S and a molecular weight of 481.57 g/mol. Its IUPAC name is (6R)-9-(3-methoxypropoxy)-3,3-dimethyl-15-oxo-10-thiophen-3-yl-4-oxa-1-azatetracyclo[11.4.0.02,6.07,12]heptadeca-7(12),8,10,13,16-pentaene-16-carboxylic acid.
| Compound Name | (6R)-9-(3-methoxypropoxy)-3,3-dimethyl-15-oxo-10-thiophen-3-yl-4-oxa-1-azatetracyclo[11.4.0.02,6.07,12]heptadeca-7(12),8,10,13,16-pentaene-16-carboxylic acid |
|---|---|
| PubChem CID | 139336204 |
| Molecular Formula | C26H27NO6S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | (6R)-9-(3-methoxypropoxy)-3,3-dimethyl-15-oxo-10-thiophen-3-yl-4-oxa-1-azatetracyclo[11.4.0.02,6.07,12]heptadeca-7(12),8,10,13,16-pentaene-16-carboxylic acid |
| SMILES | COCCCOc1cc2c(cc1-c1ccsc1)-c1cc(=O)c(C(=O)O)cn1C1[C@@H]2COC1(C)C |
| InChI | InChI=1S/C26H27NO6S/c1-26(2)24-20(13-33-26)17-10-23(32-7-4-6-31-3)16(15-5-8-34-14-15)9-18(17)21-11-22(28)19(25(29)30)12-27(21)24/h5,8-12,14,20,24H,4,6-7,13H2,1-3H3,(H,29,30)/t20-,24?/m1/s1 |
| InChIKey | NRONISDWBDPHJP-CGHJUBPDSA-N |
| XLogP | 4.80 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|