C38H41N5O6 — CID 139336900
(E)-N-[4-[2-amino-5-(3,4-dimethoxyphenyl)-3-pyridinyl]phenyl]-2-formyl-3-[[methyl-(4-methylphenyl)carbamoyl]-(oxan-4-ylmethyl)amino]prop-2-enamide (PubChem CID 139336900) has the molecular formula C38H41N5O6 and a molecular weight of 663.78 g/mol. Its IUPAC name is (E)-N-[4-[2-amino-5-(3,4-dimethoxyphenyl)-3-pyridinyl]phenyl]-2-formyl-3-[[methyl-(4-methylphenyl)carbamoyl]-(oxan-4-ylmethyl)amino]prop-2-enamide.
| Compound Name | (E)-N-[4-[2-amino-5-(3,4-dimethoxyphenyl)-3-pyridinyl]phenyl]-2-formyl-3-[[methyl-(4-methylphenyl)carbamoyl]-(oxan-4-ylmethyl)amino]prop-2-enamide |
|---|---|
| PubChem CID | 139336900 |
| Molecular Formula | C38H41N5O6 |
| Molecular Weight | 663.78 g/mol |
| Exact Mass | 663.31 |
| IUPAC Name | (E)-N-[4-[2-amino-5-(3,4-dimethoxyphenyl)-3-pyridinyl]phenyl]-2-formyl-3-[[methyl-(4-methylphenyl)carbamoyl]-(oxan-4-ylmethyl)amino]prop-2-enamide |
| SMILES | COc1ccc(-c2cnc(N)c(-c3ccc(NC(=O)/C(C=O)=C/N(CC4CCOCC4)C(=O)N(C)c4ccc(C)cc4)cc3)c2)cc1OC |
| InChI | InChI=1S/C38H41N5O6/c1-25-5-12-32(13-6-25)42(2)38(46)43(22-26-15-17-49-18-16-26)23-30(24-44)37(45)41-31-10-7-27(8-11-31)33-19-29(21-40-36(33)39)28-9-14-34(47-3)35(20-28)48-4/h5-14,19-21,23-24,26H,15-18,22H2,1-4H3,(H2,39,40)(H,41,45)/b30-23+ |
| InChIKey | VOBUANOHJZWASL-JJKYIXSRSA-N |
| XLogP | 6.33 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.78 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|