About 6,7-di(propan-2-yl)-3-oxabicyclo[3.2.0]hepta-1,4-diene
6,7-di(propan-2-yl)-3-oxabicyclo[3.2.0]hepta-1,4-diene (PubChem CID 139337753) has the molecular formula C12H18O
and a molecular weight of 178.27 g/mol. Its IUPAC name is 6,7-di(propan-2-yl)-3-oxabicyclo[3.2.0]hepta-1,4-diene.
Molecular Properties
| Compound Name | 6,7-di(propan-2-yl)-3-oxabicyclo[3.2.0]hepta-1,4-diene |
| PubChem CID | 139337753 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 6,7-di(propan-2-yl)-3-oxabicyclo[3.2.0]hepta-1,4-diene |
| SMILES | CC(C)C1c2cocc2C1C(C)C |
| InChI | InChI=1S/C12H18O/c1-7(2)11-9-5-13-6-10(9)12(11)8(3)4/h5-8,11-12H,1-4H3 |
| InChIKey | MFOCDXPHBWMFMB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6,7-di(propan-2-yl)-3-oxabicyclo[3.2.0]hepta-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-di(propan-2-yl)-3-oxabicyclo[3.2.0]hepta-1,4-diene?
The IUPAC name of 6,7-di(propan-2-yl)-3-oxabicyclo[3.2.0]hepta-1,4-diene (CID 139337753) is 6,7-di(propan-2-yl)-3-oxabicyclo[3.2.0]hepta-1,4-diene.
What is the SMILES notation for 6,7-di(propan-2-yl)-3-oxabicyclo[3.2.0]hepta-1,4-diene?
The canonical SMILES for 6,7-di(propan-2-yl)-3-oxabicyclo[3.2.0]hepta-1,4-diene is CC(C)C1c2cocc2C1C(C)C.
What is the InChIKey of 6,7-di(propan-2-yl)-3-oxabicyclo[3.2.0]hepta-1,4-diene?
The InChIKey is MFOCDXPHBWMFMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O/c1-7(2)11-9-5-13-6-10(9)12(11)8(3)4/h5-8,11-12H,1-4H3.
What are the key properties of 6,7-di(propan-2-yl)-3-oxabicyclo[3.2.0]hepta-1,4-diene?
6,7-di(propan-2-yl)-3-oxabicyclo[3.2.0]hepta-1,4-diene has a molecular weight of 178.27 g/mol, XLogP of 3.77, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-di(propan-2-yl)-3-oxabicyclo[3.2.0]hepta-1,4-diene is sourced from PubChem (CID 139337753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).