About (5E,6E)-5,6-di(ethylidene)-4-oxopyran-2-carboxylic acid
(5E,6E)-5,6-di(ethylidene)-4-oxopyran-2-carboxylic acid (PubChem CID 139338173) has the molecular formula C10H10O4
and a molecular weight of 194.19 g/mol. Its IUPAC name is (5E,6E)-5,6-di(ethylidene)-4-oxopyran-2-carboxylic acid.
Molecular Properties
| Compound Name | (5E,6E)-5,6-di(ethylidene)-4-oxopyran-2-carboxylic acid |
| PubChem CID | 139338173 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | (5E,6E)-5,6-di(ethylidene)-4-oxopyran-2-carboxylic acid |
| SMILES | C/C=c1/oc(C(=O)O)cc(=O)/c1=C/C |
| InChI | InChI=1S/C10H10O4/c1-3-6-7(11)5-9(10(12)13)14-8(6)4-2/h3-5H,1-2H3,(H,12,13)/b6-3-,8-4+ |
| InChIKey | HPEXUQYPLVHHAN-TTZRGRENSA-N |
| XLogP | -0.06 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5E,6E)-5,6-di(ethylidene)-4-oxopyran-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E,6E)-5,6-di(ethylidene)-4-oxopyran-2-carboxylic acid?
The IUPAC name of (5E,6E)-5,6-di(ethylidene)-4-oxopyran-2-carboxylic acid (CID 139338173) is (5E,6E)-5,6-di(ethylidene)-4-oxopyran-2-carboxylic acid.
What is the SMILES notation for (5E,6E)-5,6-di(ethylidene)-4-oxopyran-2-carboxylic acid?
The canonical SMILES for (5E,6E)-5,6-di(ethylidene)-4-oxopyran-2-carboxylic acid is C/C=c1/oc(C(=O)O)cc(=O)/c1=C/C.
What is the InChIKey of (5E,6E)-5,6-di(ethylidene)-4-oxopyran-2-carboxylic acid?
The InChIKey is HPEXUQYPLVHHAN-TTZRGRENSA-N. The full InChI is InChI=1S/C10H10O4/c1-3-6-7(11)5-9(10(12)13)14-8(6)4-2/h3-5H,1-2H3,(H,12,13)/b6-3-,8-4+.
What are the key properties of (5E,6E)-5,6-di(ethylidene)-4-oxopyran-2-carboxylic acid?
(5E,6E)-5,6-di(ethylidene)-4-oxopyran-2-carboxylic acid has a molecular weight of 194.19 g/mol, XLogP of -0.06, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5E,6E)-5,6-di(ethylidene)-4-oxopyran-2-carboxylic acid is sourced from PubChem (CID 139338173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).