C16H24F3N5O2 — CID 139338179
tert-butyl 4-[N-[C-cyano-N-(1,1,1-trifluoropropan-2-yl)carbonimidoyl]-C-methylcarbonimidoyl]piperazine-1-carboxylate (PubChem CID 139338179) has the molecular formula C16H24F3N5O2 and a molecular weight of 375.40 g/mol. Its IUPAC name is tert-butyl 4-[N-[C-cyano-N-(1,1,1-trifluoropropan-2-yl)carbonimidoyl]-C-methylcarbonimidoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[N-[C-cyano-N-(1,1,1-trifluoropropan-2-yl)carbonimidoyl]-C-methylcarbonimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 139338179 |
| Molecular Formula | C16H24F3N5O2 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | tert-butyl 4-[N-[C-cyano-N-(1,1,1-trifluoropropan-2-yl)carbonimidoyl]-C-methylcarbonimidoyl]piperazine-1-carboxylate |
| SMILES | C/C(=N\C(C#N)=N\C(C)C(F)(F)F)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H24F3N5O2/c1-11(16(17,18)19)21-13(10-20)22-12(2)23-6-8-24(9-7-23)14(25)26-15(3,4)5/h11H,6-9H2,1-5H3/b21-13+,22-12+ |
| InChIKey | UXDVOJNWTKMGNT-XWVFJUEBSA-N |
| XLogP | 2.83 |
| TPSA | 81.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|