C13H14BrFN6O5 — CID 139339125
2-amino-4-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]oxybutanoic acid (PubChem CID 139339125) has the molecular formula C13H14BrFN6O5 and a molecular weight of 433.19 g/mol. Its IUPAC name is 2-amino-4-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]oxybutanoic acid.
| Compound Name | 2-amino-4-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]oxybutanoic acid |
|---|---|
| PubChem CID | 139339125 |
| Molecular Formula | C13H14BrFN6O5 |
| Molecular Weight | 433.19 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | 2-amino-4-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]oxybutanoic acid |
| SMILES | NC(CCONc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO)C(=O)O |
| InChI | InChI=1S/C13H14BrFN6O5/c14-7-5-6(1-2-8(7)15)17-11(18-24)10-12(21-26-19-10)20-25-4-3-9(16)13(22)23/h1-2,5,9,24H,3-4,16H2,(H,17,18)(H,20,21)(H,22,23) |
| InChIKey | VVGYWPSDHNXBCG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 168.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.19 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|