C9H7ClFN5O2S — CID 139339133
N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-(sulfanylamino)-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 139339133) has the molecular formula C9H7ClFN5O2S and a molecular weight of 303.71 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-(sulfanylamino)-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-(sulfanylamino)-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 139339133 |
| Molecular Formula | C9H7ClFN5O2S |
| Molecular Weight | 303.71 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-(sulfanylamino)-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | ON/C(=N\c1ccc(F)c(Cl)c1)c1nonc1NS |
| InChI | InChI=1S/C9H7ClFN5O2S/c10-5-3-4(1-2-6(5)11)12-8(13-17)7-9(16-19)15-18-14-7/h1-3,17,19H,(H,12,13)(H,15,16) |
| InChIKey | VYKIIYVVPSGUGU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.71 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|