C27H34F3N9O4 — CID 139339146
tert-butyl (3S)-3-[[4-[6-[(Z)-N'-hydroxycarbamimidoyl]-1-(oxan-2-yl)pyrazolo[5,4-b]pyridin-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate (PubChem CID 139339146) has the molecular formula C27H34F3N9O4 and a molecular weight of 605.62 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[4-[6-[(Z)-N'-hydroxycarbamimidoyl]-1-(oxan-2-yl)pyrazolo[5,4-b]pyridin-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[4-[6-[(Z)-N'-hydroxycarbamimidoyl]-1-(oxan-2-yl)pyrazolo[5,4-b]pyridin-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 139339146 |
| Molecular Formula | C27H34F3N9O4 |
| Molecular Weight | 605.62 g/mol |
| Exact Mass | 605.27 |
| IUPAC Name | tert-butyl (3S)-3-[[4-[6-[(Z)-N'-hydroxycarbamimidoyl]-1-(oxan-2-yl)pyrazolo[5,4-b]pyridin-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](Nc2ncc(C(F)(F)F)c(-c3nn(C4CCCCO4)c4nc(/C(N)=N/O)ccc34)n2)C1 |
| InChI | InChI=1S/C27H34F3N9O4/c1-26(2,3)43-25(40)38-11-6-7-15(14-38)33-24-32-13-17(27(28,29)30)21(35-24)20-16-9-10-18(22(31)37-41)34-23(16)39(36-20)19-8-4-5-12-42-19/h9-10,13,15,19,41H,4-8,11-12,14H2,1-3H3,(H2,31,37)(H,32,33,35)/t15-,19?/m0/s1 |
| InChIKey | IQHBSCVUEOYNCS-FUKCDUGKSA-N |
| XLogP | 4.51 |
| TPSA | 165.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.62 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|