C15H14BrFN6O5 — CID 139339335
N'-(3-bromo-4-fluorophenyl)-4-[2-(2,5-dioxopyrrolidin-1-yl)ethoxyamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 139339335) has the molecular formula C15H14BrFN6O5 and a molecular weight of 457.22 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-4-[2-(2,5-dioxopyrrolidin-1-yl)ethoxyamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-4-[2-(2,5-dioxopyrrolidin-1-yl)ethoxyamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 139339335 |
| Molecular Formula | C15H14BrFN6O5 |
| Molecular Weight | 457.22 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-4-[2-(2,5-dioxopyrrolidin-1-yl)ethoxyamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | O=C1CCC(=O)N1CCONc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C15H14BrFN6O5/c16-9-7-8(1-2-10(9)17)18-14(19-26)13-15(22-28-20-13)21-27-6-5-23-11(24)3-4-12(23)25/h1-2,7,26H,3-6H2,(H,18,19)(H,21,22) |
| InChIKey | DKTRCJBWIPBXEY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 142.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|