C14H17BrFN7O5S — CID 139339348
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[[1-[(sulfamoylamino)methyl]cyclopropyl]methoxyamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 139339348) has the molecular formula C14H17BrFN7O5S and a molecular weight of 494.30 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[[1-[(sulfamoylamino)methyl]cyclopropyl]methoxyamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[[1-[(sulfamoylamino)methyl]cyclopropyl]methoxyamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 139339348 |
| Molecular Formula | C14H17BrFN7O5S |
| Molecular Weight | 494.30 g/mol |
| Exact Mass | 493.02 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[[1-[(sulfamoylamino)methyl]cyclopropyl]methoxyamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NS(=O)(=O)NCC1(CONc2nonc2/C(=N/c2ccc(F)c(Br)c2)NO)CC1 |
| InChI | InChI=1S/C14H17BrFN7O5S/c15-9-5-8(1-2-10(9)16)19-12(20-24)11-13(23-28-21-11)22-27-7-14(3-4-14)6-18-29(17,25)26/h1-2,5,18,24H,3-4,6-7H2,(H,19,20)(H,22,23)(H2,17,25,26) |
| InChIKey | QZJMVNQILSSVOQ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 176.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|