C11H12BrFN6O3 — CID 139339368
4-(2-aminoethoxyamino)-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 139339368) has the molecular formula C11H12BrFN6O3 and a molecular weight of 375.16 g/mol. Its IUPAC name is 4-(2-aminoethoxyamino)-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-(2-aminoethoxyamino)-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 139339368 |
| Molecular Formula | C11H12BrFN6O3 |
| Molecular Weight | 375.16 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | 4-(2-aminoethoxyamino)-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NCCONc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C11H12BrFN6O3/c12-7-5-6(1-2-8(7)13)15-10(16-20)9-11(19-22-17-9)18-21-4-3-14/h1-2,5,20H,3-4,14H2,(H,15,16)(H,18,19) |
| InChIKey | OOQRVGIPRZNYNM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 130.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.16 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|