C13H15BrFN5O3 — CID 139339377
N'-(3-bromo-4-fluorophenyl)-4-(butoxyamino)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 139339377) has the molecular formula C13H15BrFN5O3 and a molecular weight of 388.20 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-4-(butoxyamino)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-4-(butoxyamino)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 139339377 |
| Molecular Formula | C13H15BrFN5O3 |
| Molecular Weight | 388.20 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-4-(butoxyamino)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CCCCONc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C13H15BrFN5O3/c1-2-3-6-22-19-13-11(18-23-20-13)12(17-21)16-8-4-5-10(15)9(14)7-8/h4-5,7,21H,2-3,6H2,1H3,(H,16,17)(H,19,20) |
| InChIKey | BICYJFIJELPBAA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 104.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.20 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|