C15H18BrFN6O3 — CID 139339382
4-[(4-aminocyclohexyl)oxyamino]-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 139339382) has the molecular formula C15H18BrFN6O3 and a molecular weight of 429.25 g/mol. Its IUPAC name is 4-[(4-aminocyclohexyl)oxyamino]-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-[(4-aminocyclohexyl)oxyamino]-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 139339382 |
| Molecular Formula | C15H18BrFN6O3 |
| Molecular Weight | 429.25 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 4-[(4-aminocyclohexyl)oxyamino]-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NC1CCC(ONc2nonc2/C(=N/c2ccc(F)c(Br)c2)NO)CC1 |
| InChI | InChI=1S/C15H18BrFN6O3/c16-11-7-9(3-6-12(11)17)19-14(20-24)13-15(23-26-21-13)22-25-10-4-1-8(18)2-5-10/h3,6-8,10,24H,1-2,4-5,18H2,(H,19,20)(H,22,23) |
| InChIKey | BUUVZFIMEHMTNW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 130.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|