C16H12BrFN6O4 — CID 139339579
[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino] N-phenylcarbamate (PubChem CID 139339579) has the molecular formula C16H12BrFN6O4 and a molecular weight of 451.21 g/mol. Its IUPAC name is [[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino] N-phenylcarbamate.
| Compound Name | [[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino] N-phenylcarbamate |
|---|---|
| PubChem CID | 139339579 |
| Molecular Formula | C16H12BrFN6O4 |
| Molecular Weight | 451.21 g/mol |
| Exact Mass | 450.01 |
| IUPAC Name | [[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)ONc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C16H12BrFN6O4/c17-11-8-10(6-7-12(11)18)19-14(21-26)13-15(24-28-22-13)23-27-16(25)20-9-4-2-1-3-5-9/h1-8,26H,(H,19,21)(H,20,25)(H,23,24) |
| InChIKey | QWCLYSLUZIFMQB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 133.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.21 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|