C18H22F2N8O — CID 139340172
N'-[4-[2-(difluoromethyl)benzimidazol-1-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]-N-methylethane-1,2-diamine (PubChem CID 139340172) has the molecular formula C18H22F2N8O and a molecular weight of 404.43 g/mol. Its IUPAC name is N'-[4-[2-(difluoromethyl)benzimidazol-1-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]-N-methylethane-1,2-diamine.
| Compound Name | N'-[4-[2-(difluoromethyl)benzimidazol-1-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 139340172 |
| Molecular Formula | C18H22F2N8O |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | N'-[4-[2-(difluoromethyl)benzimidazol-1-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]-N-methylethane-1,2-diamine |
| SMILES | CNCCNc1nc(N2CCOCC2)nc(-n2c(C(F)F)nc3ccccc32)n1 |
| InChI | InChI=1S/C18H22F2N8O/c1-21-6-7-22-16-24-17(27-8-10-29-11-9-27)26-18(25-16)28-13-5-3-2-4-12(13)23-15(28)14(19)20/h2-5,14,21H,6-11H2,1H3,(H,22,24,25,26) |
| InChIKey | QKGDICWSMXXAKY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|