C17H16Cl2OS3 — CID 139340758
1,2-dichloro-4-[[[(Z)-3-(3-methoxyphenyl)sulfanylprop-1-enyl]disulfanyl]methyl]benzene (PubChem CID 139340758) has the molecular formula C17H16Cl2OS3 and a molecular weight of 403.42 g/mol. Its IUPAC name is 1,2-dichloro-4-[[[(Z)-3-(3-methoxyphenyl)sulfanylprop-1-enyl]disulfanyl]methyl]benzene.
| Compound Name | 1,2-dichloro-4-[[[(Z)-3-(3-methoxyphenyl)sulfanylprop-1-enyl]disulfanyl]methyl]benzene |
|---|---|
| PubChem CID | 139340758 |
| Molecular Formula | C17H16Cl2OS3 |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 401.97 |
| IUPAC Name | 1,2-dichloro-4-[[[(Z)-3-(3-methoxyphenyl)sulfanylprop-1-enyl]disulfanyl]methyl]benzene |
| SMILES | COc1cccc(SC/C=C\SSCc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C17H16Cl2OS3/c1-20-14-4-2-5-15(11-14)21-8-3-9-22-23-12-13-6-7-16(18)17(19)10-13/h2-7,9-11H,8,12H2,1H3/b9-3- |
| InChIKey | FRPGCXIZAPLHFV-OQFOIZHKSA-N |
| XLogP | 7.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|