About N'-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-N-ethyloxamide
N'-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-N-ethyloxamide (PubChem CID 139341058) has the molecular formula C12H18N4O2
and a molecular weight of 250.30 g/mol. Its IUPAC name is N'-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-N-ethyloxamide.
Molecular Properties
| Compound Name | N'-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-N-ethyloxamide |
| PubChem CID | 139341058 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | N'-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-N-ethyloxamide |
| SMILES | CCNC(=O)C(=O)NCc1c(C)cc(N)nc1C |
| InChI | InChI=1S/C12H18N4O2/c1-4-14-11(17)12(18)15-6-9-7(2)5-10(13)16-8(9)3/h5H,4,6H2,1-3H3,(H2,13,16)(H,14,17)(H,15,18) |
| InChIKey | YQWPFJXAGVCYKJ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-N-ethyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-N-ethyloxamide?
The IUPAC name of N'-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-N-ethyloxamide (CID 139341058) is N'-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-N-ethyloxamide.
What is the SMILES notation for N'-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-N-ethyloxamide?
The canonical SMILES for N'-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-N-ethyloxamide is CCNC(=O)C(=O)NCc1c(C)cc(N)nc1C.
What is the InChIKey of N'-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-N-ethyloxamide?
The InChIKey is YQWPFJXAGVCYKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O2/c1-4-14-11(17)12(18)15-6-9-7(2)5-10(13)16-8(9)3/h5H,4,6H2,1-3H3,(H2,13,16)(H,14,17)(H,15,18).
What are the key properties of N'-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-N-ethyloxamide?
N'-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-N-ethyloxamide has a molecular weight of 250.30 g/mol, XLogP of 0.03, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-N-ethyloxamide is sourced from PubChem (CID 139341058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).