C21H28FN2O8P — CID 139341146
(E)-3-[[2-[2-(diethoxymethyl)phenoxy]-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-methylamino]-2-fluoro-N-formylprop-2-enamide (PubChem CID 139341146) has the molecular formula C21H28FN2O8P and a molecular weight of 486.43 g/mol. Its IUPAC name is (E)-3-[[2-[2-(diethoxymethyl)phenoxy]-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-methylamino]-2-fluoro-N-formylprop-2-enamide.
| Compound Name | (E)-3-[[2-[2-(diethoxymethyl)phenoxy]-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-methylamino]-2-fluoro-N-formylprop-2-enamide |
|---|---|
| PubChem CID | 139341146 |
| Molecular Formula | C21H28FN2O8P |
| Molecular Weight | 486.43 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | (E)-3-[[2-[2-(diethoxymethyl)phenoxy]-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-methylamino]-2-fluoro-N-formylprop-2-enamide |
| SMILES | CCOC(OCC)c1ccccc1OP1OCC2OC(N(C)/C=C(/F)C(=O)NC=O)CC2O1 |
| InChI | InChI=1S/C21H28FN2O8P/c1-4-27-21(28-5-2)14-8-6-7-9-16(14)31-33-29-12-18-17(32-33)10-19(30-18)24(3)11-15(22)20(26)23-13-25/h6-9,11,13,17-19,21H,4-5,10,12H2,1-3H3,(H,23,25,26)/b15-11+ |
| InChIKey | XAOFFSNAWNCWKS-RVDMUPIBSA-N |
| XLogP | 2.91 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|