About N-fluoro-N,2,4-trimethylpenta-1,3-dien-3-amine
N-fluoro-N,2,4-trimethylpenta-1,3-dien-3-amine (PubChem CID 139341424) has the molecular formula C8H14FN
and a molecular weight of 143.20 g/mol. Its IUPAC name is N-fluoro-N,2,4-trimethylpenta-1,3-dien-3-amine.
Molecular Properties
| Compound Name | N-fluoro-N,2,4-trimethylpenta-1,3-dien-3-amine |
| PubChem CID | 139341424 |
| Molecular Formula | C8H14FN |
| Molecular Weight | 143.20 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | N-fluoro-N,2,4-trimethylpenta-1,3-dien-3-amine |
| SMILES | C=C(C)C(=C(C)C)N(C)F |
| InChI | InChI=1S/C8H14FN/c1-6(2)8(7(3)4)10(5)9/h1H2,2-5H3 |
| InChIKey | NHJMIGQMUYLPIF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.20 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-fluoro-N,2,4-trimethylpenta-1,3-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-fluoro-N,2,4-trimethylpenta-1,3-dien-3-amine?
The IUPAC name of N-fluoro-N,2,4-trimethylpenta-1,3-dien-3-amine (CID 139341424) is N-fluoro-N,2,4-trimethylpenta-1,3-dien-3-amine.
What is the SMILES notation for N-fluoro-N,2,4-trimethylpenta-1,3-dien-3-amine?
The canonical SMILES for N-fluoro-N,2,4-trimethylpenta-1,3-dien-3-amine is C=C(C)C(=C(C)C)N(C)F.
What is the InChIKey of N-fluoro-N,2,4-trimethylpenta-1,3-dien-3-amine?
The InChIKey is NHJMIGQMUYLPIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14FN/c1-6(2)8(7(3)4)10(5)9/h1H2,2-5H3.
What are the key properties of N-fluoro-N,2,4-trimethylpenta-1,3-dien-3-amine?
N-fluoro-N,2,4-trimethylpenta-1,3-dien-3-amine has a molecular weight of 143.20 g/mol, XLogP of 2.67, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-fluoro-N,2,4-trimethylpenta-1,3-dien-3-amine is sourced from PubChem (CID 139341424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).