About (E)-3-(1-tert-butyl-5,5-difluoropiperidin-3-yl)-2-methylprop-2-enoic acid
(E)-3-(1-tert-butyl-5,5-difluoropiperidin-3-yl)-2-methylprop-2-enoic acid (PubChem CID 139341809) has the molecular formula C13H21F2NO2
and a molecular weight of 261.31 g/mol. Its IUPAC name is (E)-3-(1-tert-butyl-5,5-difluoropiperidin-3-yl)-2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | (E)-3-(1-tert-butyl-5,5-difluoropiperidin-3-yl)-2-methylprop-2-enoic acid |
| PubChem CID | 139341809 |
| Molecular Formula | C13H21F2NO2 |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | (E)-3-(1-tert-butyl-5,5-difluoropiperidin-3-yl)-2-methylprop-2-enoic acid |
| SMILES | C/C(=C\C1CN(C(C)(C)C)CC(F)(F)C1)C(=O)O |
| InChI | InChI=1S/C13H21F2NO2/c1-9(11(17)18)5-10-6-13(14,15)8-16(7-10)12(2,3)4/h5,10H,6-8H2,1-4H3,(H,17,18)/b9-5+ |
| InChIKey | FLSRQXDJXKQWJJ-WEVVVXLNSA-N |
| XLogP | 2.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(1-tert-butyl-5,5-difluoropiperidin-3-yl)-2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(1-tert-butyl-5,5-difluoropiperidin-3-yl)-2-methylprop-2-enoic acid?
The IUPAC name of (E)-3-(1-tert-butyl-5,5-difluoropiperidin-3-yl)-2-methylprop-2-enoic acid (CID 139341809) is (E)-3-(1-tert-butyl-5,5-difluoropiperidin-3-yl)-2-methylprop-2-enoic acid.
What is the SMILES notation for (E)-3-(1-tert-butyl-5,5-difluoropiperidin-3-yl)-2-methylprop-2-enoic acid?
The canonical SMILES for (E)-3-(1-tert-butyl-5,5-difluoropiperidin-3-yl)-2-methylprop-2-enoic acid is C/C(=C\C1CN(C(C)(C)C)CC(F)(F)C1)C(=O)O.
What is the InChIKey of (E)-3-(1-tert-butyl-5,5-difluoropiperidin-3-yl)-2-methylprop-2-enoic acid?
The InChIKey is FLSRQXDJXKQWJJ-WEVVVXLNSA-N. The full InChI is InChI=1S/C13H21F2NO2/c1-9(11(17)18)5-10-6-13(14,15)8-16(7-10)12(2,3)4/h5,10H,6-8H2,1-4H3,(H,17,18)/b9-5+.
What are the key properties of (E)-3-(1-tert-butyl-5,5-difluoropiperidin-3-yl)-2-methylprop-2-enoic acid?
(E)-3-(1-tert-butyl-5,5-difluoropiperidin-3-yl)-2-methylprop-2-enoic acid has a molecular weight of 261.31 g/mol, XLogP of 2.77, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(1-tert-butyl-5,5-difluoropiperidin-3-yl)-2-methylprop-2-enoic acid is sourced from PubChem (CID 139341809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).