About 2-(acetamidomethyl)-1,3-oxazole-4-carboxamide
2-(acetamidomethyl)-1,3-oxazole-4-carboxamide (PubChem CID 139342044) has the molecular formula C7H9N3O3
and a molecular weight of 183.17 g/mol. Its IUPAC name is 2-(acetamidomethyl)-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(acetamidomethyl)-1,3-oxazole-4-carboxamide |
| PubChem CID | 139342044 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 2-(acetamidomethyl)-1,3-oxazole-4-carboxamide |
| SMILES | CC(=O)NCc1nc(C(N)=O)co1 |
| InChI | InChI=1S/C7H9N3O3/c1-4(11)9-2-6-10-5(3-13-6)7(8)12/h3H,2H2,1H3,(H2,8,12)(H,9,11) |
| InChIKey | FXQLATGJBKJROM-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(acetamidomethyl)-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(acetamidomethyl)-1,3-oxazole-4-carboxamide?
The IUPAC name of 2-(acetamidomethyl)-1,3-oxazole-4-carboxamide (CID 139342044) is 2-(acetamidomethyl)-1,3-oxazole-4-carboxamide.
What is the SMILES notation for 2-(acetamidomethyl)-1,3-oxazole-4-carboxamide?
The canonical SMILES for 2-(acetamidomethyl)-1,3-oxazole-4-carboxamide is CC(=O)NCc1nc(C(N)=O)co1.
What is the InChIKey of 2-(acetamidomethyl)-1,3-oxazole-4-carboxamide?
The InChIKey is FXQLATGJBKJROM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O3/c1-4(11)9-2-6-10-5(3-13-6)7(8)12/h3H,2H2,1H3,(H2,8,12)(H,9,11).
What are the key properties of 2-(acetamidomethyl)-1,3-oxazole-4-carboxamide?
2-(acetamidomethyl)-1,3-oxazole-4-carboxamide has a molecular weight of 183.17 g/mol, XLogP of -0.59, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(acetamidomethyl)-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 139342044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).