About 2-[2-(acetamidomethyl)-1,3-oxazol-4-yl]-1,3-oxazole-4-carboxamide
2-[2-(acetamidomethyl)-1,3-oxazol-4-yl]-1,3-oxazole-4-carboxamide (PubChem CID 139342045) has the molecular formula C10H10N4O4
and a molecular weight of 250.21 g/mol. Its IUPAC name is 2-[2-(acetamidomethyl)-1,3-oxazol-4-yl]-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-[2-(acetamidomethyl)-1,3-oxazol-4-yl]-1,3-oxazole-4-carboxamide |
| PubChem CID | 139342045 |
| Molecular Formula | C10H10N4O4 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 2-[2-(acetamidomethyl)-1,3-oxazol-4-yl]-1,3-oxazole-4-carboxamide |
| SMILES | CC(=O)NCc1nc(-c2nc(C(N)=O)co2)co1 |
| InChI | InChI=1S/C10H10N4O4/c1-5(15)12-2-8-13-7(4-17-8)10-14-6(3-18-10)9(11)16/h3-4H,2H2,1H3,(H2,11,16)(H,12,15) |
| InChIKey | OEQLHLXOLFVEMJ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 124.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[2-(acetamidomethyl)-1,3-oxazol-4-yl]-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(acetamidomethyl)-1,3-oxazol-4-yl]-1,3-oxazole-4-carboxamide?
The IUPAC name of 2-[2-(acetamidomethyl)-1,3-oxazol-4-yl]-1,3-oxazole-4-carboxamide (CID 139342045) is 2-[2-(acetamidomethyl)-1,3-oxazol-4-yl]-1,3-oxazole-4-carboxamide.
What is the SMILES notation for 2-[2-(acetamidomethyl)-1,3-oxazol-4-yl]-1,3-oxazole-4-carboxamide?
The canonical SMILES for 2-[2-(acetamidomethyl)-1,3-oxazol-4-yl]-1,3-oxazole-4-carboxamide is CC(=O)NCc1nc(-c2nc(C(N)=O)co2)co1.
What is the InChIKey of 2-[2-(acetamidomethyl)-1,3-oxazol-4-yl]-1,3-oxazole-4-carboxamide?
The InChIKey is OEQLHLXOLFVEMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O4/c1-5(15)12-2-8-13-7(4-17-8)10-14-6(3-18-10)9(11)16/h3-4H,2H2,1H3,(H2,11,16)(H,12,15).
What are the key properties of 2-[2-(acetamidomethyl)-1,3-oxazol-4-yl]-1,3-oxazole-4-carboxamide?
2-[2-(acetamidomethyl)-1,3-oxazol-4-yl]-1,3-oxazole-4-carboxamide has a molecular weight of 250.21 g/mol, XLogP of 0.06, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(acetamidomethyl)-1,3-oxazol-4-yl]-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 139342045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).