About 8-ethyl-7-methyl-5,6-dihydro-4aH-pyrido[2,3-b]azepine
8-ethyl-7-methyl-5,6-dihydro-4aH-pyrido[2,3-b]azepine (PubChem CID 139342539) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 8-ethyl-7-methyl-5,6-dihydro-4aH-pyrido[2,3-b]azepine.
Molecular Properties
| Compound Name | 8-ethyl-7-methyl-5,6-dihydro-4aH-pyrido[2,3-b]azepine |
| PubChem CID | 139342539 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 8-ethyl-7-methyl-5,6-dihydro-4aH-pyrido[2,3-b]azepine |
| SMILES | CCC1=C(C)CCC2C=CC=NC2=N1 |
| InChI | InChI=1S/C12H16N2/c1-3-11-9(2)6-7-10-5-4-8-13-12(10)14-11/h4-5,8,10H,3,6-7H2,1-2H3 |
| InChIKey | OPKNNQCVMIZLPL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-ethyl-7-methyl-5,6-dihydro-4aH-pyrido[2,3-b]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethyl-7-methyl-5,6-dihydro-4aH-pyrido[2,3-b]azepine?
The IUPAC name of 8-ethyl-7-methyl-5,6-dihydro-4aH-pyrido[2,3-b]azepine (CID 139342539) is 8-ethyl-7-methyl-5,6-dihydro-4aH-pyrido[2,3-b]azepine.
What is the SMILES notation for 8-ethyl-7-methyl-5,6-dihydro-4aH-pyrido[2,3-b]azepine?
The canonical SMILES for 8-ethyl-7-methyl-5,6-dihydro-4aH-pyrido[2,3-b]azepine is CCC1=C(C)CCC2C=CC=NC2=N1.
What is the InChIKey of 8-ethyl-7-methyl-5,6-dihydro-4aH-pyrido[2,3-b]azepine?
The InChIKey is OPKNNQCVMIZLPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2/c1-3-11-9(2)6-7-10-5-4-8-13-12(10)14-11/h4-5,8,10H,3,6-7H2,1-2H3.
What are the key properties of 8-ethyl-7-methyl-5,6-dihydro-4aH-pyrido[2,3-b]azepine?
8-ethyl-7-methyl-5,6-dihydro-4aH-pyrido[2,3-b]azepine has a molecular weight of 188.27 g/mol, XLogP of 3.12, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyl-7-methyl-5,6-dihydro-4aH-pyrido[2,3-b]azepine is sourced from PubChem (CID 139342539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).