C57H34N4O2 — CID 139342651
1-[7-[4-dibenzofuran-3-yl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]dibenzofuran-2-yl]-9-phenylcarbazole (PubChem CID 139342651) has the molecular formula C57H34N4O2 and a molecular weight of 806.93 g/mol. Its IUPAC name is 1-[7-[4-dibenzofuran-3-yl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]dibenzofuran-2-yl]-9-phenylcarbazole.
| Compound Name | 1-[7-[4-dibenzofuran-3-yl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]dibenzofuran-2-yl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 139342651 |
| Molecular Formula | C57H34N4O2 |
| Molecular Weight | 806.93 g/mol |
| Exact Mass | 806.27 |
| IUPAC Name | 1-[7-[4-dibenzofuran-3-yl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]dibenzofuran-2-yl]-9-phenylcarbazole |
| SMILES | c1ccc(-c2cccc(-c3nc(-c4ccc5c(c4)oc4ccccc45)nc(-c4ccc5c(c4)oc4ccc(-c6cccc7c8ccccc8n(-c8ccccc8)c67)cc45)n3)c2)cc1 |
| InChI | InChI=1S/C57H34N4O2/c1-3-13-35(14-4-1)36-15-11-16-38(31-36)55-58-56(39-25-28-45-44-20-8-10-24-50(44)62-52(45)33-39)60-57(59-55)40-26-29-46-48-32-37(27-30-51(48)63-53(46)34-40)42-21-12-22-47-43-19-7-9-23-49(43)61(54(42)47)41-17-5-2-6-18-41/h1-34H |
| InChIKey | ZRZQDXVHPPDKPR-UHFFFAOYSA-N |
| XLogP | 15.10 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.93 |
| LogP ≤ 5 | 15.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |