About N-[[5-(dimethylamino)-4,4-difluoropiperidin-3-yl]methyl]methanesulfonamide
N-[[5-(dimethylamino)-4,4-difluoropiperidin-3-yl]methyl]methanesulfonamide (PubChem CID 139343709) has the molecular formula C9H19F2N3O2S
and a molecular weight of 271.33 g/mol. Its IUPAC name is N-[[5-(dimethylamino)-4,4-difluoropiperidin-3-yl]methyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[[5-(dimethylamino)-4,4-difluoropiperidin-3-yl]methyl]methanesulfonamide |
| PubChem CID | 139343709 |
| Molecular Formula | C9H19F2N3O2S |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N-[[5-(dimethylamino)-4,4-difluoropiperidin-3-yl]methyl]methanesulfonamide |
| SMILES | CN(C)C1CNCC(CNS(C)(=O)=O)C1(F)F |
| InChI | InChI=1S/C9H19F2N3O2S/c1-14(2)8-6-12-4-7(9(8,10)11)5-13-17(3,15)16/h7-8,12-13H,4-6H2,1-3H3 |
| InChIKey | ZOPMJUUAPDHEQA-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[5-(dimethylamino)-4,4-difluoropiperidin-3-yl]methyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-(dimethylamino)-4,4-difluoropiperidin-3-yl]methyl]methanesulfonamide?
The IUPAC name of N-[[5-(dimethylamino)-4,4-difluoropiperidin-3-yl]methyl]methanesulfonamide (CID 139343709) is N-[[5-(dimethylamino)-4,4-difluoropiperidin-3-yl]methyl]methanesulfonamide.
What is the SMILES notation for N-[[5-(dimethylamino)-4,4-difluoropiperidin-3-yl]methyl]methanesulfonamide?
The canonical SMILES for N-[[5-(dimethylamino)-4,4-difluoropiperidin-3-yl]methyl]methanesulfonamide is CN(C)C1CNCC(CNS(C)(=O)=O)C1(F)F.
What is the InChIKey of N-[[5-(dimethylamino)-4,4-difluoropiperidin-3-yl]methyl]methanesulfonamide?
The InChIKey is ZOPMJUUAPDHEQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19F2N3O2S/c1-14(2)8-6-12-4-7(9(8,10)11)5-13-17(3,15)16/h7-8,12-13H,4-6H2,1-3H3.
What are the key properties of N-[[5-(dimethylamino)-4,4-difluoropiperidin-3-yl]methyl]methanesulfonamide?
N-[[5-(dimethylamino)-4,4-difluoropiperidin-3-yl]methyl]methanesulfonamide has a molecular weight of 271.33 g/mol, XLogP of -0.68, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-(dimethylamino)-4,4-difluoropiperidin-3-yl]methyl]methanesulfonamide is sourced from PubChem (CID 139343709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).