C27H33Cl2FN4O2 — CID 139344254
3-[(3R)-3-[3-[5-chloro-4-[1-(4-chloro-2-fluorophenyl)ethylamino]pyrimidin-2-yl]cyclobutyl]piperidin-1-yl]-1-methylcyclobutane-1-carboxylic acid (PubChem CID 139344254) has the molecular formula C27H33Cl2FN4O2 and a molecular weight of 535.49 g/mol. Its IUPAC name is 3-[(3R)-3-[3-[5-chloro-4-[1-(4-chloro-2-fluorophenyl)ethylamino]pyrimidin-2-yl]cyclobutyl]piperidin-1-yl]-1-methylcyclobutane-1-carboxylic acid.
| Compound Name | 3-[(3R)-3-[3-[5-chloro-4-[1-(4-chloro-2-fluorophenyl)ethylamino]pyrimidin-2-yl]cyclobutyl]piperidin-1-yl]-1-methylcyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 139344254 |
| Molecular Formula | C27H33Cl2FN4O2 |
| Molecular Weight | 535.49 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | 3-[(3R)-3-[3-[5-chloro-4-[1-(4-chloro-2-fluorophenyl)ethylamino]pyrimidin-2-yl]cyclobutyl]piperidin-1-yl]-1-methylcyclobutane-1-carboxylic acid |
| SMILES | CC(Nc1nc(C2CC([C@H]3CCCN(C4CC(C)(C(=O)O)C4)C3)C2)ncc1Cl)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C27H33Cl2FN4O2/c1-15(21-6-5-19(28)10-23(21)30)32-25-22(29)13-31-24(33-25)18-8-17(9-18)16-4-3-7-34(14-16)20-11-27(2,12-20)26(35)36/h5-6,10,13,15-18,20H,3-4,7-9,11-12,14H2,1-2H3,(H,35,36)(H,31,32,33)/t15?,16-,17?,18?,20?,27?/m0/s1 |
| InChIKey | AGEHVMUQKYPLAU-FCEXNQLYSA-N |
| XLogP | 6.55 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.49 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |