About 3-[4-(3,5-dimethylpiperazin-1-yl)pyrimidin-2-yl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine
3-[4-(3,5-dimethylpiperazin-1-yl)pyrimidin-2-yl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine (PubChem CID 139344644) has the molecular formula C18H19F3N6
and a molecular weight of 376.39 g/mol. Its IUPAC name is 3-[4-(3,5-dimethylpiperazin-1-yl)pyrimidin-2-yl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 3-[4-(3,5-dimethylpiperazin-1-yl)pyrimidin-2-yl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine |
| PubChem CID | 139344644 |
| Molecular Formula | C18H19F3N6 |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 3-[4-(3,5-dimethylpiperazin-1-yl)pyrimidin-2-yl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine |
| SMILES | CC1CN(c2ccnc(-c3cnc4ccc(C(F)(F)F)cn34)n2)CC(C)N1 |
| InChI | InChI=1S/C18H19F3N6/c1-11-8-26(9-12(2)24-11)16-5-6-22-17(25-16)14-7-23-15-4-3-13(10-27(14)15)18(19,20)21/h3-7,10-12,24H,8-9H2,1-2H3 |
| InChIKey | DKFXVSAKTVXPLO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[4-(3,5-dimethylpiperazin-1-yl)pyrimidin-2-yl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(3,5-dimethylpiperazin-1-yl)pyrimidin-2-yl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine?
The IUPAC name of 3-[4-(3,5-dimethylpiperazin-1-yl)pyrimidin-2-yl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine (CID 139344644) is 3-[4-(3,5-dimethylpiperazin-1-yl)pyrimidin-2-yl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine.
What is the SMILES notation for 3-[4-(3,5-dimethylpiperazin-1-yl)pyrimidin-2-yl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine?
The canonical SMILES for 3-[4-(3,5-dimethylpiperazin-1-yl)pyrimidin-2-yl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine is CC1CN(c2ccnc(-c3cnc4ccc(C(F)(F)F)cn34)n2)CC(C)N1.
What is the InChIKey of 3-[4-(3,5-dimethylpiperazin-1-yl)pyrimidin-2-yl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine?
The InChIKey is DKFXVSAKTVXPLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19F3N6/c1-11-8-26(9-12(2)24-11)16-5-6-22-17(25-16)14-7-23-15-4-3-13(10-27(14)15)18(19,20)21/h3-7,10-12,24H,8-9H2,1-2H3.
What are the key properties of 3-[4-(3,5-dimethylpiperazin-1-yl)pyrimidin-2-yl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine?
3-[4-(3,5-dimethylpiperazin-1-yl)pyrimidin-2-yl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine has a molecular weight of 376.39 g/mol, XLogP of 3.00, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(3,5-dimethylpiperazin-1-yl)pyrimidin-2-yl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine is sourced from PubChem (CID 139344644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).