C22H22FN5O5 — CID 139344982
ethyl 1-[(4-fluoro-2-nitrophenyl)methyl]-7-methyl-5-(1H-pyrrole-2-carbonyl)-6,7-dihydro-4H-pyrazolo[4,5-c]pyridine-3-carboxylate (PubChem CID 139344982) has the molecular formula C22H22FN5O5 and a molecular weight of 455.45 g/mol. Its IUPAC name is ethyl 1-[(4-fluoro-2-nitrophenyl)methyl]-7-methyl-5-(1H-pyrrole-2-carbonyl)-6,7-dihydro-4H-pyrazolo[4,5-c]pyridine-3-carboxylate.
| Compound Name | ethyl 1-[(4-fluoro-2-nitrophenyl)methyl]-7-methyl-5-(1H-pyrrole-2-carbonyl)-6,7-dihydro-4H-pyrazolo[4,5-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 139344982 |
| Molecular Formula | C22H22FN5O5 |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | ethyl 1-[(4-fluoro-2-nitrophenyl)methyl]-7-methyl-5-(1H-pyrrole-2-carbonyl)-6,7-dihydro-4H-pyrazolo[4,5-c]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1nn(Cc2ccc(F)cc2[N+](=O)[O-])c2c1CN(C(=O)c1ccc[nH]1)CC2C |
| InChI | InChI=1S/C22H22FN5O5/c1-3-33-22(30)19-16-12-26(21(29)17-5-4-8-24-17)10-13(2)20(16)27(25-19)11-14-6-7-15(23)9-18(14)28(31)32/h4-9,13,24H,3,10-12H2,1-2H3 |
| InChIKey | BOOOYACXSUVOMB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 123.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|