About 4-aminobutanoic acid;4-hydroxychromen-2-one
4-aminobutanoic acid;4-hydroxychromen-2-one (PubChem CID 139345020) has the molecular formula C13H15NO5
and a molecular weight of 265.27 g/mol. Its IUPAC name is 4-aminobutanoic acid;4-hydroxychromen-2-one.
Molecular Properties
| Compound Name | 4-aminobutanoic acid;4-hydroxychromen-2-one |
| PubChem CID | 139345020 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 4-aminobutanoic acid;4-hydroxychromen-2-one |
| SMILES | NCCCC(=O)O.O=c1cc(O)c2ccccc2o1 |
| InChI | InChI=1S/C9H6O3.C4H9NO2/c10-7-5-9(11)12-8-4-2-1-3-6(7)8;5-3-1-2-4(6)7/h1-5,10H;1-3,5H2,(H,6,7) |
| InChIKey | RMZVNEVODOPPIC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobutanoic acid;4-hydroxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobutanoic acid;4-hydroxychromen-2-one?
The IUPAC name of 4-aminobutanoic acid;4-hydroxychromen-2-one (CID 139345020) is 4-aminobutanoic acid;4-hydroxychromen-2-one.
What is the SMILES notation for 4-aminobutanoic acid;4-hydroxychromen-2-one?
The canonical SMILES for 4-aminobutanoic acid;4-hydroxychromen-2-one is NCCCC(=O)O.O=c1cc(O)c2ccccc2o1.
What is the InChIKey of 4-aminobutanoic acid;4-hydroxychromen-2-one?
The InChIKey is RMZVNEVODOPPIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O3.C4H9NO2/c10-7-5-9(11)12-8-4-2-1-3-6(7)8;5-3-1-2-4(6)7/h1-5,10H;1-3,5H2,(H,6,7).
What are the key properties of 4-aminobutanoic acid;4-hydroxychromen-2-one?
4-aminobutanoic acid;4-hydroxychromen-2-one has a molecular weight of 265.27 g/mol, XLogP of 1.31, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobutanoic acid;4-hydroxychromen-2-one is sourced from PubChem (CID 139345020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).