C19H25N6O2+ — CID 139346380
N-(3-amino-6-ethylpyrazin-2-yl)-N-[(3-ethyl-5-methoxy-1-methylbenzimidazol-1-ium-2-yl)methyl]formamide (PubChem CID 139346380) has the molecular formula C19H25N6O2+ and a molecular weight of 369.45 g/mol. Its IUPAC name is N-(3-amino-6-ethylpyrazin-2-yl)-N-[(3-ethyl-5-methoxy-1-methylbenzimidazol-1-ium-2-yl)methyl]formamide.
| Compound Name | N-(3-amino-6-ethylpyrazin-2-yl)-N-[(3-ethyl-5-methoxy-1-methylbenzimidazol-1-ium-2-yl)methyl]formamide |
|---|---|
| PubChem CID | 139346380 |
| Molecular Formula | C19H25N6O2+ |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | N-(3-amino-6-ethylpyrazin-2-yl)-N-[(3-ethyl-5-methoxy-1-methylbenzimidazol-1-ium-2-yl)methyl]formamide |
| SMILES | CCc1cnc(N)c(N(C=O)Cc2n(CC)c3cc(OC)ccc3[n+]2C)n1 |
| InChI | InChI=1S/C19H25N6O2/c1-5-13-10-21-18(20)19(22-13)24(12-26)11-17-23(3)15-8-7-14(27-4)9-16(15)25(17)6-2/h7-10,12H,5-6,11H2,1-4H3,(H2,20,21)/q+1 |
| InChIKey | ZURZMQOBZSELIN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|