C20H22F3N5O3S — CID 139346502
1-(piperidin-4-ylamino)-10H-phenothiazine-3-carbohydrazide;2,2,2-trifluoroacetic acid (PubChem CID 139346502) has the molecular formula C20H22F3N5O3S and a molecular weight of 469.49 g/mol. Its IUPAC name is 1-(piperidin-4-ylamino)-10H-phenothiazine-3-carbohydrazide;2,2,2-trifluoroacetic acid.
| Compound Name | 1-(piperidin-4-ylamino)-10H-phenothiazine-3-carbohydrazide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 139346502 |
| Molecular Formula | C20H22F3N5O3S |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 1-(piperidin-4-ylamino)-10H-phenothiazine-3-carbohydrazide;2,2,2-trifluoroacetic acid |
| SMILES | NNC(=O)c1cc(NC2CCNCC2)c2c(c1)Sc1ccccc1N2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H21N5OS.C2HF3O2/c19-23-18(24)11-9-14(21-12-5-7-20-8-6-12)17-16(10-11)25-15-4-2-1-3-13(15)22-17;3-2(4,5)1(6)7/h1-4,9-10,12,20-22H,5-8,19H2,(H,23,24);(H,6,7) |
| InChIKey | PLSWXITWRZWPKE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|