C28H36FN3O3 — CID 139346978
3-[[1-[2-(cyclohexylmethyl)pent-4-enoyl]-4-hydroxypiperidin-4-yl]methyl]-6-(2-fluorophenyl)pyrimidin-4-one (PubChem CID 139346978) has the molecular formula C28H36FN3O3 and a molecular weight of 481.61 g/mol. Its IUPAC name is 3-[[1-[2-(cyclohexylmethyl)pent-4-enoyl]-4-hydroxypiperidin-4-yl]methyl]-6-(2-fluorophenyl)pyrimidin-4-one.
| Compound Name | 3-[[1-[2-(cyclohexylmethyl)pent-4-enoyl]-4-hydroxypiperidin-4-yl]methyl]-6-(2-fluorophenyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 139346978 |
| Molecular Formula | C28H36FN3O3 |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | 3-[[1-[2-(cyclohexylmethyl)pent-4-enoyl]-4-hydroxypiperidin-4-yl]methyl]-6-(2-fluorophenyl)pyrimidin-4-one |
| SMILES | C=CCC(CC1CCCCC1)C(=O)N1CCC(O)(Cn2cnc(-c3ccccc3F)cc2=O)CC1 |
| InChI | InChI=1S/C28H36FN3O3/c1-2-8-22(17-21-9-4-3-5-10-21)27(34)31-15-13-28(35,14-16-31)19-32-20-30-25(18-26(32)33)23-11-6-7-12-24(23)29/h2,6-7,11-12,18,20-22,35H,1,3-5,8-10,13-17,19H2 |
| InChIKey | UNEBZWGBLIVBRP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|