C18H22FN3O4 — CID 139347544
3-(3-fluorophenyl)-2-[(1S,4R)-4-(methoxycarbamoyl)cyclopent-2-en-1-yl]-5-methyl-1,2-oxazolidine-5-carboxamide (PubChem CID 139347544) has the molecular formula C18H22FN3O4 and a molecular weight of 363.39 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-2-[(1S,4R)-4-(methoxycarbamoyl)cyclopent-2-en-1-yl]-5-methyl-1,2-oxazolidine-5-carboxamide.
| Compound Name | 3-(3-fluorophenyl)-2-[(1S,4R)-4-(methoxycarbamoyl)cyclopent-2-en-1-yl]-5-methyl-1,2-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 139347544 |
| Molecular Formula | C18H22FN3O4 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 3-(3-fluorophenyl)-2-[(1S,4R)-4-(methoxycarbamoyl)cyclopent-2-en-1-yl]-5-methyl-1,2-oxazolidine-5-carboxamide |
| SMILES | CONC(=O)[C@H]1C=C[C@@H](N2OC(C)(C(N)=O)CC2c2cccc(F)c2)C1 |
| InChI | InChI=1S/C18H22FN3O4/c1-18(17(20)24)10-15(11-4-3-5-13(19)8-11)22(26-18)14-7-6-12(9-14)16(23)21-25-2/h3-8,12,14-15H,9-10H2,1-2H3,(H2,20,24)(H,21,23)/t12-,14+,15?,18?/m0/s1 |
| InChIKey | RXHHDISFWVJNJG-DPWBBVDGSA-N |
| XLogP | 1.37 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|